C29H42O4 — CID 21257865
2-[2-butyl-4-[1-[3-butyl-4-(2-hydroxyethoxy)phenyl]cyclopentyl]phenoxy]ethanol (PubChem CID 21257865) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is 2-[2-butyl-4-[1-[3-butyl-4-(2-hydroxyethoxy)phenyl]cyclopentyl]phenoxy]ethanol.
| Compound Name | 2-[2-butyl-4-[1-[3-butyl-4-(2-hydroxyethoxy)phenyl]cyclopentyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 21257865 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 2-[2-butyl-4-[1-[3-butyl-4-(2-hydroxyethoxy)phenyl]cyclopentyl]phenoxy]ethanol |
| SMILES | CCCCc1cc(C2(c3ccc(OCCO)c(CCCC)c3)CCCC2)ccc1OCCO |
| InChI | InChI=1S/C29H42O4/c1-3-5-9-23-21-25(11-13-27(23)32-19-17-30)29(15-7-8-16-29)26-12-14-28(33-20-18-31)24(22-26)10-6-4-2/h11-14,21-22,30-31H,3-10,15-20H2,1-2H3 |
| InChIKey | LAGGIKXICCEGIC-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |