C32H40O8 — CID 102581574
[1-hydroxy-3-[4-[1-[4-(3-hydroxy-3-prop-2-enoyloxypropoxy)-3-methylphenyl]cyclohexyl]-2-methylphenoxy]propyl] prop-2-enoate (PubChem CID 102581574) has the molecular formula C32H40O8 and a molecular weight of 552.66 g/mol. Its IUPAC name is [1-hydroxy-3-[4-[1-[4-(3-hydroxy-3-prop-2-enoyloxypropoxy)-3-methylphenyl]cyclohexyl]-2-methylphenoxy]propyl] prop-2-enoate.
| Compound Name | [1-hydroxy-3-[4-[1-[4-(3-hydroxy-3-prop-2-enoyloxypropoxy)-3-methylphenyl]cyclohexyl]-2-methylphenoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 102581574 |
| Molecular Formula | C32H40O8 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | [1-hydroxy-3-[4-[1-[4-(3-hydroxy-3-prop-2-enoyloxypropoxy)-3-methylphenyl]cyclohexyl]-2-methylphenoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(O)CCOc1ccc(C2(c3ccc(OCCC(O)OC(=O)C=C)c(C)c3)CCCCC2)cc1C |
| InChI | InChI=1S/C32H40O8/c1-5-28(33)39-30(35)14-18-37-26-12-10-24(20-22(26)3)32(16-8-7-9-17-32)25-11-13-27(23(4)21-25)38-19-15-31(36)40-29(34)6-2/h5-6,10-13,20-21,30-31,35-36H,1-2,7-9,14-19H2,3-4H3 |
| InChIKey | VMZNIDHYGWPGMZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|