C25H26O4 — CID 59739110
[2-methyl-4-[1-(3-methyl-4-prop-2-enoyloxyphenyl)cyclopentyl]phenyl] prop-2-enoate (PubChem CID 59739110) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is [2-methyl-4-[1-(3-methyl-4-prop-2-enoyloxyphenyl)cyclopentyl]phenyl] prop-2-enoate.
| Compound Name | [2-methyl-4-[1-(3-methyl-4-prop-2-enoyloxyphenyl)cyclopentyl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 59739110 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [2-methyl-4-[1-(3-methyl-4-prop-2-enoyloxyphenyl)cyclopentyl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(C2(c3ccc(OC(=O)C=C)c(C)c3)CCCC2)cc1C |
| InChI | InChI=1S/C25H26O4/c1-5-23(26)28-21-11-9-19(15-17(21)3)25(13-7-8-14-25)20-10-12-22(18(4)16-20)29-24(27)6-2/h5-6,9-12,15-16H,1-2,7-8,13-14H2,3-4H3 |
| InChIKey | ZOKYNJPHAVWVDQ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|