C34H34O4 — CID 153279975
[4-[1-(4-methoxy-3-methylphenyl)cyclohexyl]-2-methylphenyl] 4-acetylnaphthalene-1-carboxylate (PubChem CID 153279975) has the molecular formula C34H34O4 and a molecular weight of 506.64 g/mol. Its IUPAC name is [4-[1-(4-methoxy-3-methylphenyl)cyclohexyl]-2-methylphenyl] 4-acetylnaphthalene-1-carboxylate.
| Compound Name | [4-[1-(4-methoxy-3-methylphenyl)cyclohexyl]-2-methylphenyl] 4-acetylnaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 153279975 |
| Molecular Formula | C34H34O4 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | [4-[1-(4-methoxy-3-methylphenyl)cyclohexyl]-2-methylphenyl] 4-acetylnaphthalene-1-carboxylate |
| SMILES | COc1ccc(C2(c3ccc(OC(=O)c4ccc(C(C)=O)c5ccccc45)c(C)c3)CCCCC2)cc1C |
| InChI | InChI=1S/C34H34O4/c1-22-20-25(12-16-31(22)37-4)34(18-8-5-9-19-34)26-13-17-32(23(2)21-26)38-33(36)30-15-14-27(24(3)35)28-10-6-7-11-29(28)30/h6-7,10-17,20-21H,5,8-9,18-19H2,1-4H3 |
| InChIKey | ZZIPXRNJXZEEQS-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|