C29H30O4 — CID 23547410
[4-[1-(4-methoxy-3-methylphenyl)cyclopentyl]-2-methylphenyl] 3-acetylbenzoate (PubChem CID 23547410) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is [4-[1-(4-methoxy-3-methylphenyl)cyclopentyl]-2-methylphenyl] 3-acetylbenzoate.
| Compound Name | [4-[1-(4-methoxy-3-methylphenyl)cyclopentyl]-2-methylphenyl] 3-acetylbenzoate |
|---|---|
| PubChem CID | 23547410 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [4-[1-(4-methoxy-3-methylphenyl)cyclopentyl]-2-methylphenyl] 3-acetylbenzoate |
| SMILES | COc1ccc(C2(c3ccc(OC(=O)c4cccc(C(C)=O)c4)c(C)c3)CCCC2)cc1C |
| InChI | InChI=1S/C29H30O4/c1-19-16-24(10-12-26(19)32-4)29(14-5-6-15-29)25-11-13-27(20(2)17-25)33-28(31)23-9-7-8-22(18-23)21(3)30/h7-13,16-18H,5-6,14-15H2,1-4H3 |
| InChIKey | QUZLSAUEXDSBQG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|