C25H32O4 — CID 20718251
1-(2-ethenoxyethoxy)-4-[1-[4-(2-methoxyethoxy)phenyl]cyclohexyl]benzene (PubChem CID 20718251) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-(2-ethenoxyethoxy)-4-[1-[4-(2-methoxyethoxy)phenyl]cyclohexyl]benzene.
| Compound Name | 1-(2-ethenoxyethoxy)-4-[1-[4-(2-methoxyethoxy)phenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 20718251 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 1-(2-ethenoxyethoxy)-4-[1-[4-(2-methoxyethoxy)phenyl]cyclohexyl]benzene |
| SMILES | C=COCCOc1ccc(C2(c3ccc(OCCOC)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C25H32O4/c1-3-27-18-20-29-24-13-9-22(10-14-24)25(15-5-4-6-16-25)21-7-11-23(12-8-21)28-19-17-26-2/h3,7-14H,1,4-6,15-20H2,2H3 |
| InChIKey | POIXMOVPALSVDF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|