C27H34N2O4 — CID 20798540
2-ethenoxyethyl N-[4-[1-[4-(2-ethenoxyethylamino)phenyl]cyclohexyl]phenyl]carbamate (PubChem CID 20798540) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-ethenoxyethyl N-[4-[1-[4-(2-ethenoxyethylamino)phenyl]cyclohexyl]phenyl]carbamate.
| Compound Name | 2-ethenoxyethyl N-[4-[1-[4-(2-ethenoxyethylamino)phenyl]cyclohexyl]phenyl]carbamate |
|---|---|
| PubChem CID | 20798540 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 2-ethenoxyethyl N-[4-[1-[4-(2-ethenoxyethylamino)phenyl]cyclohexyl]phenyl]carbamate |
| SMILES | C=COCCNc1ccc(C2(c3ccc(NC(=O)OCCOC=C)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C27H34N2O4/c1-3-31-19-18-28-24-12-8-22(9-13-24)27(16-6-5-7-17-27)23-10-14-25(15-11-23)29-26(30)33-21-20-32-4-2/h3-4,8-15,28H,1-2,5-7,16-21H2,(H,29,30) |
| InChIKey | DIJOOBSSMFKGFG-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|