C22H26N2O4 — CID 20798549
ethenoxymethyl N-[4-[2-[4-(ethenoxymethylamino)phenyl]propan-2-yl]phenyl]carbamate (PubChem CID 20798549) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is ethenoxymethyl N-[4-[2-[4-(ethenoxymethylamino)phenyl]propan-2-yl]phenyl]carbamate.
| Compound Name | ethenoxymethyl N-[4-[2-[4-(ethenoxymethylamino)phenyl]propan-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 20798549 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | ethenoxymethyl N-[4-[2-[4-(ethenoxymethylamino)phenyl]propan-2-yl]phenyl]carbamate |
| SMILES | C=COCNc1ccc(C(C)(C)c2ccc(NC(=O)OCOC=C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-5-26-15-23-19-11-7-17(8-12-19)22(3,4)18-9-13-20(14-10-18)24-21(25)28-16-27-6-2/h5-14,23H,1-2,15-16H2,3-4H3,(H,24,25) |
| InChIKey | DMYOKMFJNXODAZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|