C30H42N2O2 — CID 4831534
2-methyl-N-[4-[1-[4-(2-methylpentanoylamino)phenyl]cyclohexyl]phenyl]pentanamide (PubChem CID 4831534) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is 2-methyl-N-[4-[1-[4-(2-methylpentanoylamino)phenyl]cyclohexyl]phenyl]pentanamide.
| Compound Name | 2-methyl-N-[4-[1-[4-(2-methylpentanoylamino)phenyl]cyclohexyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 4831534 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | 2-methyl-N-[4-[1-[4-(2-methylpentanoylamino)phenyl]cyclohexyl]phenyl]pentanamide |
| SMILES | CCCC(C)C(=O)Nc1ccc(C2(c3ccc(NC(=O)C(C)CCC)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C30H42N2O2/c1-5-10-22(3)28(33)31-26-16-12-24(13-17-26)30(20-8-7-9-21-30)25-14-18-27(19-15-25)32-29(34)23(4)11-6-2/h12-19,22-23H,5-11,20-21H2,1-4H3,(H,31,33)(H,32,34) |
| InChIKey | TUUIOECGQNJRHS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |