C46H52O8 — CID 19900927
1-(2-ethenoxyethoxy)-4-[1,3,3-tris[4-(2-ethenoxyethoxy)phenyl]cyclohexyl]benzene (PubChem CID 19900927) has the molecular formula C46H52O8 and a molecular weight of 732.91 g/mol. Its IUPAC name is 1-(2-ethenoxyethoxy)-4-[1,3,3-tris[4-(2-ethenoxyethoxy)phenyl]cyclohexyl]benzene.
| Compound Name | 1-(2-ethenoxyethoxy)-4-[1,3,3-tris[4-(2-ethenoxyethoxy)phenyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19900927 |
| Molecular Formula | C46H52O8 |
| Molecular Weight | 732.91 g/mol |
| Exact Mass | 732.37 |
| IUPAC Name | 1-(2-ethenoxyethoxy)-4-[1,3,3-tris[4-(2-ethenoxyethoxy)phenyl]cyclohexyl]benzene |
| SMILES | C=COCCOc1ccc(C2(c3ccc(OCCOC=C)cc3)CCCC(c3ccc(OCCOC=C)cc3)(c3ccc(OCCOC=C)cc3)C2)cc1 |
| InChI | InChI=1S/C46H52O8/c1-5-47-28-32-51-41-18-10-37(11-19-41)45(38-12-20-42(21-13-38)52-33-29-48-6-2)26-9-27-46(36-45,39-14-22-43(23-15-39)53-34-30-49-7-3)40-16-24-44(25-17-40)54-35-31-50-8-4/h5-8,10-25H,1-4,9,26-36H2 |
| InChIKey | HIIYREJOXAGAEQ-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.91 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|