C11H17O5P — CID 87175635
ethoxy-[[3-(2-hydroxyethoxy)phenyl]methyl]phosphinic acid (PubChem CID 87175635) has the molecular formula C11H17O5P and a molecular weight of 260.23 g/mol. Its IUPAC name is ethoxy-[[3-(2-hydroxyethoxy)phenyl]methyl]phosphinic acid.
| Compound Name | ethoxy-[[3-(2-hydroxyethoxy)phenyl]methyl]phosphinic acid |
|---|---|
| PubChem CID | 87175635 |
| Molecular Formula | C11H17O5P |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | ethoxy-[[3-(2-hydroxyethoxy)phenyl]methyl]phosphinic acid |
| SMILES | CCOP(=O)(O)Cc1cccc(OCCO)c1 |
| InChI | InChI=1S/C11H17O5P/c1-2-16-17(13,14)9-10-4-3-5-11(8-10)15-7-6-12/h3-5,8,12H,2,6-7,9H2,1H3,(H,13,14) |
| InChIKey | WOZJBTFQYATSJA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|