C18H21O5P — CID 87885688
ethoxy-[2-oxo-2-[3-(2-phenylethoxy)phenyl]ethyl]phosphinic acid (PubChem CID 87885688) has the molecular formula C18H21O5P and a molecular weight of 348.34 g/mol. Its IUPAC name is ethoxy-[2-oxo-2-[3-(2-phenylethoxy)phenyl]ethyl]phosphinic acid.
| Compound Name | ethoxy-[2-oxo-2-[3-(2-phenylethoxy)phenyl]ethyl]phosphinic acid |
|---|---|
| PubChem CID | 87885688 |
| Molecular Formula | C18H21O5P |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | ethoxy-[2-oxo-2-[3-(2-phenylethoxy)phenyl]ethyl]phosphinic acid |
| SMILES | CCOP(=O)(O)CC(=O)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C18H21O5P/c1-2-23-24(20,21)14-18(19)16-9-6-10-17(13-16)22-12-11-15-7-4-3-5-8-15/h3-10,13H,2,11-12,14H2,1H3,(H,20,21) |
| InChIKey | HDJHCVBBYPLDQQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|