About sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid
sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid (PubChem CID 174747864) has the molecular formula C15H16NaO4P
and a molecular weight of 314.25 g/mol. Its IUPAC name is sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid.
Molecular Properties
| Compound Name | sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid |
| PubChem CID | 174747864 |
| Molecular Formula | C15H16NaO4P |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid |
| SMILES | O=C(CP(=O)(O)OCc1ccccc1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C15H15O4P.Na.H/c16-15(14-9-5-2-6-10-14)12-20(17,18)19-11-13-7-3-1-4-8-13;;/h1-10H,11-12H2,(H,17,18);;/q;+1;-1 |
| InChIKey | CWUYILZSFIYAQB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid?
The IUPAC name of sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid (CID 174747864) is sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid.
What is the SMILES notation for sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid?
The canonical SMILES for sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid is O=C(CP(=O)(O)OCc1ccccc1)c1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid?
The InChIKey is CWUYILZSFIYAQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15O4P.Na.H/c16-15(14-9-5-2-6-10-14)12-20(17,18)19-11-13-7-3-1-4-8-13;;/h1-10H,11-12H2,(H,17,18);;/q;+1;-1.
What are the key properties of sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid?
sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid has a molecular weight of 314.25 g/mol, XLogP of 0.39, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phenacyl(phenylmethoxy)phosphinic acid is sourced from PubChem (CID 174747864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).