C14H15O4P — CID 87885614
ethoxy-(2-naphthalen-2-yl-2-oxoethyl)phosphinic acid (PubChem CID 87885614) has the molecular formula C14H15O4P and a molecular weight of 278.24 g/mol. Its IUPAC name is ethoxy-(2-naphthalen-2-yl-2-oxoethyl)phosphinic acid.
| Compound Name | ethoxy-(2-naphthalen-2-yl-2-oxoethyl)phosphinic acid |
|---|---|
| PubChem CID | 87885614 |
| Molecular Formula | C14H15O4P |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | ethoxy-(2-naphthalen-2-yl-2-oxoethyl)phosphinic acid |
| SMILES | CCOP(=O)(O)CC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H15O4P/c1-2-18-19(16,17)10-14(15)13-8-7-11-5-3-4-6-12(11)9-13/h3-9H,2,10H2,1H3,(H,16,17) |
| InChIKey | LUQOAURUBABQRA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|