About [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate
[dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate (PubChem CID 139974854) has the molecular formula C17H22O4S2
and a molecular weight of 354.49 g/mol. Its IUPAC name is [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate.
Molecular Properties
| Compound Name | [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate |
| PubChem CID | 139974854 |
| Molecular Formula | C17H22O4S2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OS(C)(C)CC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H22O4S2/c1-4-11-23(19,20)21-22(2,3)13-17(18)16-10-9-14-7-5-6-8-15(14)12-16/h5-10,12H,4,11,13H2,1-3H3 |
| InChIKey | RESSQQJFABGOQN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate?
The IUPAC name of [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate (CID 139974854) is [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate.
What is the SMILES notation for [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate?
The canonical SMILES for [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate is CCCS(=O)(=O)OS(C)(C)CC(=O)c1ccc2ccccc2c1.
What is the InChIKey of [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate?
The InChIKey is RESSQQJFABGOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O4S2/c1-4-11-23(19,20)21-22(2,3)13-17(18)16-10-9-14-7-5-6-8-15(14)12-16/h5-10,12H,4,11,13H2,1-3H3.
What are the key properties of [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate?
[dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate has a molecular weight of 354.49 g/mol, XLogP of 3.76, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethyl-(2-naphthalen-2-yl-2-oxoethyl)-λ4-sulfanyl] propane-1-sulfonate is sourced from PubChem (CID 139974854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).