C16H26O4S2 — CID 139974908
[dimethyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]-λ4-sulfanyl] propane-1-sulfonate (PubChem CID 139974908) has the molecular formula C16H26O4S2 and a molecular weight of 346.51 g/mol. Its IUPAC name is [dimethyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]-λ4-sulfanyl] propane-1-sulfonate.
| Compound Name | [dimethyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]-λ4-sulfanyl] propane-1-sulfonate |
|---|---|
| PubChem CID | 139974908 |
| Molecular Formula | C16H26O4S2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [dimethyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]-λ4-sulfanyl] propane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OS(C)(C)CC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C16H26O4S2/c1-6-11-22(18,19)20-21(4,5)12-16(17)15-9-7-14(8-10-15)13(2)3/h7-10,13H,6,11-12H2,1-5H3 |
| InChIKey | QBCGXTSCFKLIBA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |