C16H24O3S — CID 159142469
1-[4-(3,3-dimethylbutan-2-yl)phenyl]-2-ethylsulfonylethanone (PubChem CID 159142469) has the molecular formula C16H24O3S and a molecular weight of 296.43 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylbutan-2-yl)phenyl]-2-ethylsulfonylethanone.
| Compound Name | 1-[4-(3,3-dimethylbutan-2-yl)phenyl]-2-ethylsulfonylethanone |
|---|---|
| PubChem CID | 159142469 |
| Molecular Formula | C16H24O3S |
| Molecular Weight | 296.43 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1-[4-(3,3-dimethylbutan-2-yl)phenyl]-2-ethylsulfonylethanone |
| SMILES | CCS(=O)(=O)CC(=O)c1ccc(C(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24O3S/c1-6-20(18,19)11-15(17)14-9-7-13(8-10-14)12(2)16(3,4)5/h7-10,12H,6,11H2,1-5H3 |
| InChIKey | LQWYENJVQFYXHT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |