C17H28O4S2 — CID 139975218
[dimethyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]-λ4-sulfanyl] butane-1-sulfonate (PubChem CID 139975218) has the molecular formula C17H28O4S2 and a molecular weight of 360.54 g/mol. Its IUPAC name is [dimethyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]-λ4-sulfanyl] butane-1-sulfonate.
| Compound Name | [dimethyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]-λ4-sulfanyl] butane-1-sulfonate |
|---|---|
| PubChem CID | 139975218 |
| Molecular Formula | C17H28O4S2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [dimethyl-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]-λ4-sulfanyl] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)OS(C)(C)CC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H28O4S2/c1-6-7-12-23(19,20)21-22(4,5)13-17(18)16-10-8-15(9-11-16)14(2)3/h8-11,14H,6-7,12-13H2,1-5H3 |
| InChIKey | JSCLWTUSSSREAB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |