About naphthalene;propyl propane-1-sulfonate
naphthalene;propyl propane-1-sulfonate (PubChem CID 174580262) has the molecular formula C16H22O3S
and a molecular weight of 294.42 g/mol. Its IUPAC name is naphthalene;propyl propane-1-sulfonate.
Molecular Properties
| Compound Name | naphthalene;propyl propane-1-sulfonate |
| PubChem CID | 174580262 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | naphthalene;propyl propane-1-sulfonate |
| SMILES | CCCOS(=O)(=O)CCC.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C6H14O3S/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-5-9-10(7,8)6-4-2/h1-8H;3-6H2,1-2H3 |
| InChIKey | XQSQOUOYUJKGBX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze naphthalene;propyl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;propyl propane-1-sulfonate?
The IUPAC name of naphthalene;propyl propane-1-sulfonate (CID 174580262) is naphthalene;propyl propane-1-sulfonate.
What is the SMILES notation for naphthalene;propyl propane-1-sulfonate?
The canonical SMILES for naphthalene;propyl propane-1-sulfonate is CCCOS(=O)(=O)CCC.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;propyl propane-1-sulfonate?
The InChIKey is XQSQOUOYUJKGBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.C6H14O3S/c1-2-6-10-8-4-3-7-9(10)5-1;1-3-5-9-10(7,8)6-4-2/h1-8H;3-6H2,1-2H3.
What are the key properties of naphthalene;propyl propane-1-sulfonate?
naphthalene;propyl propane-1-sulfonate has a molecular weight of 294.42 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;propyl propane-1-sulfonate is sourced from PubChem (CID 174580262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).