About propyl 1-carbamoylnaphthalene-2-sulfonate
propyl 1-carbamoylnaphthalene-2-sulfonate (PubChem CID 174480767) has the molecular formula C14H15NO4S
and a molecular weight of 293.34 g/mol. Its IUPAC name is propyl 1-carbamoylnaphthalene-2-sulfonate.
Molecular Properties
| Compound Name | propyl 1-carbamoylnaphthalene-2-sulfonate |
| PubChem CID | 174480767 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | propyl 1-carbamoylnaphthalene-2-sulfonate |
| SMILES | CCCOS(=O)(=O)c1ccc2ccccc2c1C(N)=O |
| InChI | InChI=1S/C14H15NO4S/c1-2-9-19-20(17,18)12-8-7-10-5-3-4-6-11(10)13(12)14(15)16/h3-8H,2,9H2,1H3,(H2,15,16) |
| InChIKey | HQVATOCEOJBMCE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze propyl 1-carbamoylnaphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 1-carbamoylnaphthalene-2-sulfonate?
The IUPAC name of propyl 1-carbamoylnaphthalene-2-sulfonate (CID 174480767) is propyl 1-carbamoylnaphthalene-2-sulfonate.
What is the SMILES notation for propyl 1-carbamoylnaphthalene-2-sulfonate?
The canonical SMILES for propyl 1-carbamoylnaphthalene-2-sulfonate is CCCOS(=O)(=O)c1ccc2ccccc2c1C(N)=O.
What is the InChIKey of propyl 1-carbamoylnaphthalene-2-sulfonate?
The InChIKey is HQVATOCEOJBMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4S/c1-2-9-19-20(17,18)12-8-7-10-5-3-4-6-11(10)13(12)14(15)16/h3-8H,2,9H2,1H3,(H2,15,16).
What are the key properties of propyl 1-carbamoylnaphthalene-2-sulfonate?
propyl 1-carbamoylnaphthalene-2-sulfonate has a molecular weight of 293.34 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 1-carbamoylnaphthalene-2-sulfonate is sourced from PubChem (CID 174480767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).