C17H20N2O5S — CID 174926939
[(2-carbamoylnaphthalene-1-carbonyl)amino] pentane-1-sulfonate (PubChem CID 174926939) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is [(2-carbamoylnaphthalene-1-carbonyl)amino] pentane-1-sulfonate.
| Compound Name | [(2-carbamoylnaphthalene-1-carbonyl)amino] pentane-1-sulfonate |
|---|---|
| PubChem CID | 174926939 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [(2-carbamoylnaphthalene-1-carbonyl)amino] pentane-1-sulfonate |
| SMILES | CCCCCS(=O)(=O)ONC(=O)c1c(C(N)=O)ccc2ccccc12 |
| InChI | InChI=1S/C17H20N2O5S/c1-2-3-6-11-25(22,23)24-19-17(21)15-13-8-5-4-7-12(13)9-10-14(15)16(18)20/h4-5,7-10H,2-3,6,11H2,1H3,(H2,18,20)(H,19,21) |
| InChIKey | ZAPGZIJFDYPKPX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|