About [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate
[(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate (PubChem CID 123835156) has the molecular formula C21H27NO4S
and a molecular weight of 389.52 g/mol. Its IUPAC name is [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate.
Molecular Properties
| Compound Name | [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate |
| PubChem CID | 123835156 |
| Molecular Formula | C21H27NO4S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate |
| SMILES | CCCCCCCCS(=O)(=O)ONc1c(C)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C21H27NO4S/c1-3-4-5-6-7-10-15-27(23,24)26-22-21-16(2)25-19-14-13-17-11-8-9-12-18(17)20(19)21/h8-9,11-14,22H,3-7,10,15H2,1-2H3 |
| InChIKey | BLQLLAXAUMOPSB-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate?
The IUPAC name of [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate (CID 123835156) is [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate.
What is the SMILES notation for [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate?
The canonical SMILES for [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate is CCCCCCCCS(=O)(=O)ONc1c(C)oc2ccc3ccccc3c12.
What is the InChIKey of [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate?
The InChIKey is BLQLLAXAUMOPSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO4S/c1-3-4-5-6-7-10-15-27(23,24)26-22-21-16(2)25-19-14-13-17-11-8-9-12-18(17)20(19)21/h8-9,11-14,22H,3-7,10,15H2,1-2H3.
What are the key properties of [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate?
[(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate has a molecular weight of 389.52 g/mol, XLogP of 5.93, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2-methylbenzo[e][1]benzofuran-1-yl)amino] octane-1-sulfonate is sourced from PubChem (CID 123835156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).