About (naphthalen-2-ylamino) ethanesulfonate
(naphthalen-2-ylamino) ethanesulfonate (PubChem CID 174493691) has the molecular formula C12H13NO3S
and a molecular weight of 251.31 g/mol. Its IUPAC name is (naphthalen-2-ylamino) ethanesulfonate.
Molecular Properties
| Compound Name | (naphthalen-2-ylamino) ethanesulfonate |
| PubChem CID | 174493691 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | (naphthalen-2-ylamino) ethanesulfonate |
| SMILES | CCS(=O)(=O)ONc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H13NO3S/c1-2-17(14,15)16-13-12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13H,2H2,1H3 |
| InChIKey | YEOVZXGDCUBCQR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (naphthalen-2-ylamino) ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (naphthalen-2-ylamino) ethanesulfonate?
The IUPAC name of (naphthalen-2-ylamino) ethanesulfonate (CID 174493691) is (naphthalen-2-ylamino) ethanesulfonate.
What is the SMILES notation for (naphthalen-2-ylamino) ethanesulfonate?
The canonical SMILES for (naphthalen-2-ylamino) ethanesulfonate is CCS(=O)(=O)ONc1ccc2ccccc2c1.
What is the InChIKey of (naphthalen-2-ylamino) ethanesulfonate?
The InChIKey is YEOVZXGDCUBCQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3S/c1-2-17(14,15)16-13-12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13H,2H2,1H3.
What are the key properties of (naphthalen-2-ylamino) ethanesulfonate?
(naphthalen-2-ylamino) ethanesulfonate has a molecular weight of 251.31 g/mol, XLogP of 2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (naphthalen-2-ylamino) ethanesulfonate is sourced from PubChem (CID 174493691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).