About hydrazinyl naphthalene-2-sulfonate
hydrazinyl naphthalene-2-sulfonate (PubChem CID 87641318) has the molecular formula C10H10N2O3S
and a molecular weight of 238.27 g/mol. Its IUPAC name is hydrazinyl naphthalene-2-sulfonate.
Molecular Properties
| Compound Name | hydrazinyl naphthalene-2-sulfonate |
| PubChem CID | 87641318 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | hydrazinyl naphthalene-2-sulfonate |
| SMILES | NNOS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H10N2O3S/c11-12-15-16(13,14)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12H,11H2 |
| InChIKey | RTYFVIZMLJTGTF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazinyl naphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazinyl naphthalene-2-sulfonate?
The IUPAC name of hydrazinyl naphthalene-2-sulfonate (CID 87641318) is hydrazinyl naphthalene-2-sulfonate.
What is the SMILES notation for hydrazinyl naphthalene-2-sulfonate?
The canonical SMILES for hydrazinyl naphthalene-2-sulfonate is NNOS(=O)(=O)c1ccc2ccccc2c1.
What is the InChIKey of hydrazinyl naphthalene-2-sulfonate?
The InChIKey is RTYFVIZMLJTGTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3S/c11-12-15-16(13,14)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12H,11H2.
What are the key properties of hydrazinyl naphthalene-2-sulfonate?
hydrazinyl naphthalene-2-sulfonate has a molecular weight of 238.27 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazinyl naphthalene-2-sulfonate is sourced from PubChem (CID 87641318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).