About 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium
4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium (PubChem CID 67781866) has the molecular formula C26H38NO5S+
and a molecular weight of 476.66 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium.
Molecular Properties
| Compound Name | 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium |
| PubChem CID | 67781866 |
| Molecular Formula | C26H38NO5S+ |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.O=C(O)c1ccc(S(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C14H10O5S.C12H28N/c15-13(16)9-1-5-11(6-2-9)20(19)12-7-3-10(4-8-12)14(17)18;1-5-9-13(10-6-2,11-7-3)12-8-4/h1-8H,(H,15,16)(H,17,18);5-12H2,1-4H3/q;+1 |
| InChIKey | ZHBJPHJORNJRAT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium?
The IUPAC name of 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium (CID 67781866) is 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium.
What is the SMILES notation for 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium?
The canonical SMILES for 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium is CCC[N+](CCC)(CCC)CCC.O=C(O)c1ccc(S(=O)c2ccc(C(=O)O)cc2)cc1.
What is the InChIKey of 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium?
The InChIKey is ZHBJPHJORNJRAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O5S.C12H28N/c15-13(16)9-1-5-11(6-2-9)20(19)12-7-3-10(4-8-12)14(17)18;1-5-9-13(10-6-2,11-7-3)12-8-4/h1-8H,(H,15,16)(H,17,18);5-12H2,1-4H3/q;+1.
What are the key properties of 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium?
4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium has a molecular weight of 476.66 g/mol, XLogP of 5.69, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-carboxyphenyl)sulfinylbenzoic acid;tetrapropylazanium is sourced from PubChem (CID 67781866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).