C32H54O4 — CID 161130899
cyclohexyl 2,2-dimethylbutanoate;(3,5-ditert-butylphenyl) 2,2-dimethylbutanoate (PubChem CID 161130899) has the molecular formula C32H54O4 and a molecular weight of 502.78 g/mol. Its IUPAC name is cyclohexyl 2,2-dimethylbutanoate;(3,5-ditert-butylphenyl) 2,2-dimethylbutanoate.
| Compound Name | cyclohexyl 2,2-dimethylbutanoate;(3,5-ditert-butylphenyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 161130899 |
| Molecular Formula | C32H54O4 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.40 |
| IUPAC Name | cyclohexyl 2,2-dimethylbutanoate;(3,5-ditert-butylphenyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCCCC1.CCC(C)(C)C(=O)Oc1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H32O2.C12H22O2/c1-10-20(8,9)17(21)22-16-12-14(18(2,3)4)11-15(13-16)19(5,6)7;1-4-12(2,3)11(13)14-10-8-6-5-7-9-10/h11-13H,10H2,1-9H3;10H,4-9H2,1-3H3 |
| InChIKey | UMDZSUMRYPRSMI-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|