C22H37NO8Si — CID 58871421
tert-butyl [4-(3-triethoxysilylpropylcarbamoyloxymethyl)phenyl] carbonate (PubChem CID 58871421) has the molecular formula C22H37NO8Si and a molecular weight of 471.62 g/mol. Its IUPAC name is tert-butyl [4-(3-triethoxysilylpropylcarbamoyloxymethyl)phenyl] carbonate.
| Compound Name | tert-butyl [4-(3-triethoxysilylpropylcarbamoyloxymethyl)phenyl] carbonate |
|---|---|
| PubChem CID | 58871421 |
| Molecular Formula | C22H37NO8Si |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | tert-butyl [4-(3-triethoxysilylpropylcarbamoyloxymethyl)phenyl] carbonate |
| SMILES | CCO[Si](CCCNC(=O)OCc1ccc(OC(=O)OC(C)(C)C)cc1)(OCC)OCC |
| InChI | InChI=1S/C22H37NO8Si/c1-7-27-32(28-8-2,29-9-3)16-10-15-23-20(24)26-17-18-11-13-19(14-12-18)30-21(25)31-22(4,5)6/h11-14H,7-10,15-17H2,1-6H3,(H,23,24) |
| InChIKey | LLEQDNIAPCOIME-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|