C29H49N3O9Si — CID 101368595
benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[[3-oxo-3-(3-triethoxysilylpropylamino)propyl]amino]pentanoate (PubChem CID 101368595) has the molecular formula C29H49N3O9Si and a molecular weight of 611.81 g/mol. Its IUPAC name is benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[[3-oxo-3-(3-triethoxysilylpropylamino)propyl]amino]pentanoate.
| Compound Name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[[3-oxo-3-(3-triethoxysilylpropylamino)propyl]amino]pentanoate |
|---|---|
| PubChem CID | 101368595 |
| Molecular Formula | C29H49N3O9Si |
| Molecular Weight | 611.81 g/mol |
| Exact Mass | 611.32 |
| IUPAC Name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-[[3-oxo-3-(3-triethoxysilylpropylamino)propyl]amino]pentanoate |
| SMILES | CCO[Si](CCCNC(=O)CCNC(=O)CC[C@H](NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C29H49N3O9Si/c1-7-38-42(39-8-2,40-9-3)21-13-19-30-26(34)18-20-31-25(33)17-16-24(32-28(36)41-29(4,5)6)27(35)37-22-23-14-11-10-12-15-23/h10-12,14-15,24H,7-9,13,16-22H2,1-6H3,(H,30,34)(H,31,33)(H,32,36)/t24-/m0/s1 |
| InChIKey | UFTLRODDCWEBJD-DEOSSOPVSA-N |
| XLogP | 3.46 |
| TPSA | 150.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|