C26H43NO8Si — CID 174373801
4-[4-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]but-2-enoic acid (PubChem CID 174373801) has the molecular formula C26H43NO8Si and a molecular weight of 525.72 g/mol. Its IUPAC name is 4-[4-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]but-2-enoic acid.
| Compound Name | 4-[4-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 174373801 |
| Molecular Formula | C26H43NO8Si |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 4-[4-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]but-2-enoic acid |
| SMILES | CCO[Si](CCCNC(=O)OCCCCCCOc1ccc(CC=CC(=O)O)cc1)(OCC)OCC |
| InChI | InChI=1S/C26H43NO8Si/c1-4-33-36(34-5-2,35-6-3)22-12-19-27-26(30)32-21-10-8-7-9-20-31-24-17-15-23(16-18-24)13-11-14-25(28)29/h11,14-18H,4-10,12-13,19-22H2,1-3H3,(H,27,30)(H,28,29) |
| InChIKey | NANDNDXAYKSBNU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|