C31H53NO9Si — CID 174362404
4-[4-pentoxy-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]but-2-enoic acid (PubChem CID 174362404) has the molecular formula C31H53NO9Si and a molecular weight of 611.85 g/mol. Its IUPAC name is 4-[4-pentoxy-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]but-2-enoic acid.
| Compound Name | 4-[4-pentoxy-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]but-2-enoic acid |
|---|---|
| PubChem CID | 174362404 |
| Molecular Formula | C31H53NO9Si |
| Molecular Weight | 611.85 g/mol |
| Exact Mass | 611.35 |
| IUPAC Name | 4-[4-pentoxy-3-[6-(3-triethoxysilylpropylcarbamoyloxy)hexoxy]phenyl]but-2-enoic acid |
| SMILES | CCCCCOc1ccc(CC=CC(=O)O)cc1OCCCCCCOC(=O)NCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C31H53NO9Si/c1-5-9-12-22-36-28-20-19-27(17-15-18-30(33)34)26-29(28)37-23-13-10-11-14-24-38-31(35)32-21-16-25-42(39-6-2,40-7-3)41-8-4/h15,18-20,26H,5-14,16-17,21-25H2,1-4H3,(H,32,35)(H,33,34) |
| InChIKey | JSCMRWPBRSJMLI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.85 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|