C26H48O8 — CID 139655789
triethyl 1-hydroxy-2-(3,7,11-trimethyldodecoxy)ethane-1,1,2-tricarboxylate (PubChem CID 139655789) has the molecular formula C26H48O8 and a molecular weight of 488.66 g/mol. Its IUPAC name is triethyl 1-hydroxy-2-(3,7,11-trimethyldodecoxy)ethane-1,1,2-tricarboxylate.
| Compound Name | triethyl 1-hydroxy-2-(3,7,11-trimethyldodecoxy)ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 139655789 |
| Molecular Formula | C26H48O8 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | triethyl 1-hydroxy-2-(3,7,11-trimethyldodecoxy)ethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(OCCC(C)CCCC(C)CCCC(C)C)C(O)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C26H48O8/c1-8-31-23(27)22(26(30,24(28)32-9-2)25(29)33-10-3)34-18-17-21(7)16-12-15-20(6)14-11-13-19(4)5/h19-22,30H,8-18H2,1-7H3 |
| InChIKey | CAXOWDSLZRNYNR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|