C48H97NO7P+ — CID 125121088
2-[hydroxy-[(2R,6R,10R,14R)-6,10,14,18-tetramethyl-4-oxo-2-[[(3S,11R)-3,11,15-trimethylhexadecanoyl]oxymethyl]nonadecoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 125121088) has the molecular formula C48H97NO7P+ and a molecular weight of 831.28 g/mol. Its IUPAC name is 2-[hydroxy-[(2R,6R,10R,14R)-6,10,14,18-tetramethyl-4-oxo-2-[[(3S,11R)-3,11,15-trimethylhexadecanoyl]oxymethyl]nonadecoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R,6R,10R,14R)-6,10,14,18-tetramethyl-4-oxo-2-[[(3S,11R)-3,11,15-trimethylhexadecanoyl]oxymethyl]nonadecoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 125121088 |
| Molecular Formula | C48H97NO7P+ |
| Molecular Weight | 831.28 g/mol |
| Exact Mass | 830.70 |
| IUPAC Name | 2-[hydroxy-[(2R,6R,10R,14R)-6,10,14,18-tetramethyl-4-oxo-2-[[(3S,11R)-3,11,15-trimethylhexadecanoyl]oxymethyl]nonadecoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CC(C)CCC[C@H](C)CCCCCCC[C@H](C)CC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)CC(=O)C[C@H](C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C48H96NO7P/c1-39(2)22-18-26-41(5)24-16-14-13-15-17-25-45(9)35-48(51)54-37-46(38-56-57(52,53)55-33-32-49(10,11)12)36-47(50)34-44(8)31-21-30-43(7)29-20-28-42(6)27-19-23-40(3)4/h39-46H,13-38H2,1-12H3/p+1/t41-,42-,43-,44-,45+,46-/m1/s1 |
| InChIKey | MCQUNSGKFVLGIP-MDZNMDKWSA-O |
| XLogP | 13.63 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.28 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|