C21H46O9P2 — CID 22085342
[8-(5,5-dimethyl-9-phosphonooxynonoxy)-4,4-dimethyloctyl] dihydrogen phosphate (PubChem CID 22085342) has the molecular formula C21H46O9P2 and a molecular weight of 504.54 g/mol. Its IUPAC name is [8-(5,5-dimethyl-9-phosphonooxynonoxy)-4,4-dimethyloctyl] dihydrogen phosphate.
| Compound Name | [8-(5,5-dimethyl-9-phosphonooxynonoxy)-4,4-dimethyloctyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 22085342 |
| Molecular Formula | C21H46O9P2 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | [8-(5,5-dimethyl-9-phosphonooxynonoxy)-4,4-dimethyloctyl] dihydrogen phosphate |
| SMILES | CC(C)(CCCCOCCCCC(C)(C)CCCOP(=O)(O)O)CCCCOP(=O)(O)O |
| InChI | InChI=1S/C21H46O9P2/c1-20(2,14-7-10-18-29-31(22,23)24)12-5-8-16-28-17-9-6-13-21(3,4)15-11-19-30-32(25,26)27/h5-19H2,1-4H3,(H2,22,23,24)(H2,25,26,27) |
| InChIKey | FAOIVXHWGSWPCO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|