C20H43O8P2+ — CID 87843318
[8-(5,5-dimethyl-8-phosphonooxyoctoxy)-4,4-dimethyloctoxy]-hydroxy-oxophosphanium (PubChem CID 87843318) has the molecular formula C20H43O8P2+ and a molecular weight of 473.50 g/mol. Its IUPAC name is [8-(5,5-dimethyl-8-phosphonooxyoctoxy)-4,4-dimethyloctoxy]-hydroxy-oxophosphanium.
| Compound Name | [8-(5,5-dimethyl-8-phosphonooxyoctoxy)-4,4-dimethyloctoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87843318 |
| Molecular Formula | C20H43O8P2+ |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | [8-(5,5-dimethyl-8-phosphonooxyoctoxy)-4,4-dimethyloctoxy]-hydroxy-oxophosphanium |
| SMILES | CC(C)(CCCCOCCCCC(C)(C)CCCOP(=O)(O)O)CCCO[P+](=O)O |
| InChI | InChI=1S/C20H42O8P2/c1-19(2,13-9-17-27-29(21)22)11-5-7-15-26-16-8-6-12-20(3,4)14-10-18-28-30(23,24)25/h5-18H2,1-4H3,(H2-,21,22,23,24,25)/p+1 |
| InChIKey | BHDIQHNDUMDVRO-UHFFFAOYSA-O |
| XLogP | 5.73 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|