C16H35O6P — CID 11638943
bis(6-hydroxy-5,5-dimethylhexyl) hydrogen phosphate (PubChem CID 11638943) has the molecular formula C16H35O6P and a molecular weight of 354.42 g/mol. Its IUPAC name is bis(6-hydroxy-5,5-dimethylhexyl) hydrogen phosphate.
| Compound Name | bis(6-hydroxy-5,5-dimethylhexyl) hydrogen phosphate |
|---|---|
| PubChem CID | 11638943 |
| Molecular Formula | C16H35O6P |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | bis(6-hydroxy-5,5-dimethylhexyl) hydrogen phosphate |
| SMILES | CC(C)(CO)CCCCOP(=O)(O)OCCCCC(C)(C)CO |
| InChI | InChI=1S/C16H35O6P/c1-15(2,13-17)9-5-7-11-21-23(19,20)22-12-8-6-10-16(3,4)14-18/h17-18H,5-14H2,1-4H3,(H,19,20) |
| InChIKey | NJBBNMVJWMPYQB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|