C19H41O6P — CID 23390840
[7-(8-hydroxy-5,5-dimethyloctoxy)-3,3-dimethylheptyl] dihydrogen phosphate (PubChem CID 23390840) has the molecular formula C19H41O6P and a molecular weight of 396.51 g/mol. Its IUPAC name is [7-(8-hydroxy-5,5-dimethyloctoxy)-3,3-dimethylheptyl] dihydrogen phosphate.
| Compound Name | [7-(8-hydroxy-5,5-dimethyloctoxy)-3,3-dimethylheptyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 23390840 |
| Molecular Formula | C19H41O6P |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | [7-(8-hydroxy-5,5-dimethyloctoxy)-3,3-dimethylheptyl] dihydrogen phosphate |
| SMILES | CC(C)(CCCO)CCCCOCCCCC(C)(C)CCOP(=O)(O)O |
| InChI | InChI=1S/C19H41O6P/c1-18(2,12-9-14-20)10-5-7-15-24-16-8-6-11-19(3,4)13-17-25-26(21,22)23/h20H,5-17H2,1-4H3,(H2,21,22,23) |
| InChIKey | FJPJVXJANDTBMN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|