C20H42O4S — CID 20805278
6,6-dimethyl-10-(5-methyl-5-methylsulfonylhexoxy)decan-1-ol (PubChem CID 20805278) has the molecular formula C20H42O4S and a molecular weight of 378.62 g/mol. Its IUPAC name is 6,6-dimethyl-10-(5-methyl-5-methylsulfonylhexoxy)decan-1-ol.
| Compound Name | 6,6-dimethyl-10-(5-methyl-5-methylsulfonylhexoxy)decan-1-ol |
|---|---|
| PubChem CID | 20805278 |
| Molecular Formula | C20H42O4S |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 6,6-dimethyl-10-(5-methyl-5-methylsulfonylhexoxy)decan-1-ol |
| SMILES | CC(C)(CCCCCO)CCCCOCCCCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C20H42O4S/c1-19(2,13-7-6-10-16-21)14-8-11-17-24-18-12-9-15-20(3,4)25(5,22)23/h21H,6-18H2,1-5H3 |
| InChIKey | NRRCUAKISGBIGY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|