C25H53NO4S — CID 23390845
8-(5,5-diethyl-9-hydroxynonoxy)-4,4-diethyloctane-1-sulfonamide (PubChem CID 23390845) has the molecular formula C25H53NO4S and a molecular weight of 463.77 g/mol. Its IUPAC name is 8-(5,5-diethyl-9-hydroxynonoxy)-4,4-diethyloctane-1-sulfonamide.
| Compound Name | 8-(5,5-diethyl-9-hydroxynonoxy)-4,4-diethyloctane-1-sulfonamide |
|---|---|
| PubChem CID | 23390845 |
| Molecular Formula | C25H53NO4S |
| Molecular Weight | 463.77 g/mol |
| Exact Mass | 463.37 |
| IUPAC Name | 8-(5,5-diethyl-9-hydroxynonoxy)-4,4-diethyloctane-1-sulfonamide |
| SMILES | CCC(CC)(CCCCO)CCCCOCCCCC(CC)(CC)CCCS(N)(=O)=O |
| InChI | InChI=1S/C25H53NO4S/c1-5-24(6-2,16-9-12-20-27)17-10-13-21-30-22-14-11-18-25(7-3,8-4)19-15-23-31(26,28)29/h27H,5-23H2,1-4H3,(H2,26,28,29) |
| InChIKey | AKNHBMXSHOIMTF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.77 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|