C12H27NO4S — CID 106668491
6-(3-methoxy-3-methylbutoxy)hexane-1-sulfonamide (PubChem CID 106668491) has the molecular formula C12H27NO4S and a molecular weight of 281.42 g/mol. Its IUPAC name is 6-(3-methoxy-3-methylbutoxy)hexane-1-sulfonamide.
| Compound Name | 6-(3-methoxy-3-methylbutoxy)hexane-1-sulfonamide |
|---|---|
| PubChem CID | 106668491 |
| Molecular Formula | C12H27NO4S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 6-(3-methoxy-3-methylbutoxy)hexane-1-sulfonamide |
| SMILES | COC(C)(C)CCOCCCCCCS(N)(=O)=O |
| InChI | InChI=1S/C12H27NO4S/c1-12(2,16-3)8-10-17-9-6-4-5-7-11-18(13,14)15/h4-11H2,1-3H3,(H2,13,14,15) |
| InChIKey | IKQSKOPGDJPNTF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|