C28H56O4 — CID 22606693
10-(5,5-diethyl-10-hydroxydecoxy)-6,6-diethyldecanoic acid (PubChem CID 22606693) has the molecular formula C28H56O4 and a molecular weight of 456.75 g/mol. Its IUPAC name is 10-(5,5-diethyl-10-hydroxydecoxy)-6,6-diethyldecanoic acid.
| Compound Name | 10-(5,5-diethyl-10-hydroxydecoxy)-6,6-diethyldecanoic acid |
|---|---|
| PubChem CID | 22606693 |
| Molecular Formula | C28H56O4 |
| Molecular Weight | 456.75 g/mol |
| Exact Mass | 456.42 |
| IUPAC Name | 10-(5,5-diethyl-10-hydroxydecoxy)-6,6-diethyldecanoic acid |
| SMILES | CCC(CC)(CCCCCO)CCCCOCCCCC(CC)(CC)CCCCC(=O)O |
| InChI | InChI=1S/C28H56O4/c1-5-27(6-2,19-11-9-15-23-29)21-13-16-24-32-25-17-14-22-28(7-3,8-4)20-12-10-18-26(30)31/h29H,5-25H2,1-4H3,(H,30,31) |
| InChIKey | XDCQMOZHNALYEP-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.75 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|