C29H52N2O5 — CID 59079043
7-[5,5-diethyl-9-(3-ethyl-2,5-dioxoimidazolidin-1-yl)nonoxy]-3-ethenyl-3-ethylheptanoic acid (PubChem CID 59079043) has the molecular formula C29H52N2O5 and a molecular weight of 508.74 g/mol. Its IUPAC name is 7-[5,5-diethyl-9-(3-ethyl-2,5-dioxoimidazolidin-1-yl)nonoxy]-3-ethenyl-3-ethylheptanoic acid.
| Compound Name | 7-[5,5-diethyl-9-(3-ethyl-2,5-dioxoimidazolidin-1-yl)nonoxy]-3-ethenyl-3-ethylheptanoic acid |
|---|---|
| PubChem CID | 59079043 |
| Molecular Formula | C29H52N2O5 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.39 |
| IUPAC Name | 7-[5,5-diethyl-9-(3-ethyl-2,5-dioxoimidazolidin-1-yl)nonoxy]-3-ethenyl-3-ethylheptanoic acid |
| SMILES | C=CC(CC)(CCCCOCCCCC(CC)(CC)CCCCN1C(=O)CN(CC)C1=O)CC(=O)O |
| InChI | InChI=1S/C29H52N2O5/c1-6-28(7-2,17-11-14-20-31-25(32)24-30(10-5)27(31)35)18-12-15-21-36-22-16-13-19-29(8-3,9-4)23-26(33)34/h8H,3,6-7,9-24H2,1-2,4-5H3,(H,33,34) |
| InChIKey | XBAVZRWRQUSJQE-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|