C25H46N2O5 — CID 59296325
6-[5,5-diethyl-7-(3-ethyl-2,5-dioxoimidazolidin-1-yl)heptoxy]-2-ethyl-2-methylhexanoic acid (PubChem CID 59296325) has the molecular formula C25H46N2O5 and a molecular weight of 454.65 g/mol. Its IUPAC name is 6-[5,5-diethyl-7-(3-ethyl-2,5-dioxoimidazolidin-1-yl)heptoxy]-2-ethyl-2-methylhexanoic acid.
| Compound Name | 6-[5,5-diethyl-7-(3-ethyl-2,5-dioxoimidazolidin-1-yl)heptoxy]-2-ethyl-2-methylhexanoic acid |
|---|---|
| PubChem CID | 59296325 |
| Molecular Formula | C25H46N2O5 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 6-[5,5-diethyl-7-(3-ethyl-2,5-dioxoimidazolidin-1-yl)heptoxy]-2-ethyl-2-methylhexanoic acid |
| SMILES | CCN1CC(=O)N(CCC(CC)(CC)CCCCOCCCCC(C)(CC)C(=O)O)C1=O |
| InChI | InChI=1S/C25H46N2O5/c1-6-24(5,22(29)30)14-10-12-18-32-19-13-11-15-25(7-2,8-3)16-17-27-21(28)20-26(9-4)23(27)31/h6-20H2,1-5H3,(H,29,30) |
| InChIKey | NNPQZGVPUXDSSL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|