C30H52N4O5 — CID 22085275
3-[9-[7-(3-ethenyl-2,5-dioxoimidazolidin-1-yl)-5,5-dimethylheptoxy]-5,5-dimethylnonyl]-1-ethylimidazolidine-2,4-dione (PubChem CID 22085275) has the molecular formula C30H52N4O5 and a molecular weight of 548.77 g/mol. Its IUPAC name is 3-[9-[7-(3-ethenyl-2,5-dioxoimidazolidin-1-yl)-5,5-dimethylheptoxy]-5,5-dimethylnonyl]-1-ethylimidazolidine-2,4-dione.
| Compound Name | 3-[9-[7-(3-ethenyl-2,5-dioxoimidazolidin-1-yl)-5,5-dimethylheptoxy]-5,5-dimethylnonyl]-1-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22085275 |
| Molecular Formula | C30H52N4O5 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | 3-[9-[7-(3-ethenyl-2,5-dioxoimidazolidin-1-yl)-5,5-dimethylheptoxy]-5,5-dimethylnonyl]-1-ethylimidazolidine-2,4-dione |
| SMILES | C=CN1CC(=O)N(CCC(C)(C)CCCCOCCCCC(C)(C)CCCCN2C(=O)CN(CC)C2=O)C1=O |
| InChI | InChI=1S/C30H52N4O5/c1-7-31-23-25(35)33(27(31)37)19-12-9-15-29(3,4)16-10-13-21-39-22-14-11-17-30(5,6)18-20-34-26(36)24-32(8-2)28(34)38/h8H,2,7,9-24H2,1,3-6H3 |
| InChIKey | JWHHJONCCGKVLD-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|