C32H62N2O3 — CID 59296276
3-[9-(5,5-diethyldecoxy)-5,5-diethylnonyl]-1-ethylimidazolidine-2,4-dione (PubChem CID 59296276) has the molecular formula C32H62N2O3 and a molecular weight of 522.86 g/mol. Its IUPAC name is 3-[9-(5,5-diethyldecoxy)-5,5-diethylnonyl]-1-ethylimidazolidine-2,4-dione.
| Compound Name | 3-[9-(5,5-diethyldecoxy)-5,5-diethylnonyl]-1-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59296276 |
| Molecular Formula | C32H62N2O3 |
| Molecular Weight | 522.86 g/mol |
| Exact Mass | 522.48 |
| IUPAC Name | 3-[9-(5,5-diethyldecoxy)-5,5-diethylnonyl]-1-ethylimidazolidine-2,4-dione |
| SMILES | CCCCCC(CC)(CC)CCCCOCCCCC(CC)(CC)CCCCN1C(=O)CN(CC)C1=O |
| InChI | InChI=1S/C32H62N2O3/c1-7-13-14-21-31(8-2,9-3)23-16-19-26-37-27-20-17-24-32(10-4,11-5)22-15-18-25-34-29(35)28-33(12-6)30(34)36/h7-28H2,1-6H3 |
| InChIKey | VWZMMVZRPBOTDS-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.86 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|