C31H54N4O5 — CID 59079027
3-[3,3-diethyl-7-[5-ethyl-5-[(3-ethyl-2,5-dioxoimidazolidin-1-yl)methyl]hept-6-enoxy]heptyl]-1-ethylimidazolidine-2,4-dione (PubChem CID 59079027) has the molecular formula C31H54N4O5 and a molecular weight of 562.80 g/mol. Its IUPAC name is 3-[3,3-diethyl-7-[5-ethyl-5-[(3-ethyl-2,5-dioxoimidazolidin-1-yl)methyl]hept-6-enoxy]heptyl]-1-ethylimidazolidine-2,4-dione.
| Compound Name | 3-[3,3-diethyl-7-[5-ethyl-5-[(3-ethyl-2,5-dioxoimidazolidin-1-yl)methyl]hept-6-enoxy]heptyl]-1-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59079027 |
| Molecular Formula | C31H54N4O5 |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | 3-[3,3-diethyl-7-[5-ethyl-5-[(3-ethyl-2,5-dioxoimidazolidin-1-yl)methyl]hept-6-enoxy]heptyl]-1-ethylimidazolidine-2,4-dione |
| SMILES | C=CC(CC)(CCCCOCCCCC(CC)(CC)CCN1C(=O)CN(CC)C1=O)CN1C(=O)CN(CC)C1=O |
| InChI | InChI=1S/C31H54N4O5/c1-7-30(8-2,19-20-34-26(36)23-32(11-5)28(34)38)17-13-15-21-40-22-16-14-18-31(9-3,10-4)25-35-27(37)24-33(12-6)29(35)39/h9H,3,7-8,10-25H2,1-2,4-6H3 |
| InChIKey | TUNTVTRCMVZASU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|