C20H34N2O5 — CID 91416127
6-[5-(3-ethenyl-5-hydroxy-2-oxoimidazol-1-yl)-5-methylhexoxy]-2,2-dimethylhexanoic acid (PubChem CID 91416127) has the molecular formula C20H34N2O5 and a molecular weight of 382.50 g/mol. Its IUPAC name is 6-[5-(3-ethenyl-5-hydroxy-2-oxoimidazol-1-yl)-5-methylhexoxy]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[5-(3-ethenyl-5-hydroxy-2-oxoimidazol-1-yl)-5-methylhexoxy]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 91416127 |
| Molecular Formula | C20H34N2O5 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 6-[5-(3-ethenyl-5-hydroxy-2-oxoimidazol-1-yl)-5-methylhexoxy]-2,2-dimethylhexanoic acid |
| SMILES | C=Cn1cc(O)n(C(C)(C)CCCCOCCCCC(C)(C)C(=O)O)c1=O |
| InChI | InChI=1S/C20H34N2O5/c1-6-21-15-16(23)22(18(21)26)20(4,5)12-8-10-14-27-13-9-7-11-19(2,3)17(24)25/h6,15,23H,1,7-14H2,2-5H3,(H,24,25) |
| InChIKey | TVRGWYKSUSCGKN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|