C20H36O5 — CID 140929040
8-(5-carboxy-5-methylhexoxy)-4-ethenyl-2,2-dimethyloctanoic acid (PubChem CID 140929040) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is 8-(5-carboxy-5-methylhexoxy)-4-ethenyl-2,2-dimethyloctanoic acid.
| Compound Name | 8-(5-carboxy-5-methylhexoxy)-4-ethenyl-2,2-dimethyloctanoic acid |
|---|---|
| PubChem CID | 140929040 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | 8-(5-carboxy-5-methylhexoxy)-4-ethenyl-2,2-dimethyloctanoic acid |
| SMILES | C=CC(CCCCOCCCCC(C)(C)C(=O)O)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C20H36O5/c1-6-16(15-20(4,5)18(23)24)11-7-9-13-25-14-10-8-12-19(2,3)17(21)22/h6,16H,1,7-15H2,2-5H3,(H,21,22)(H,23,24) |
| InChIKey | XSHPNNUOKYREJB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|