C22H38N2O5 — CID 91373870
6-[7-(3-ethenyl-5-hydroxy-2-oxoimidazol-1-yl)-5,5-dimethylheptoxy]-2,2-dimethylhexanoic acid (PubChem CID 91373870) has the molecular formula C22H38N2O5 and a molecular weight of 410.56 g/mol. Its IUPAC name is 6-[7-(3-ethenyl-5-hydroxy-2-oxoimidazol-1-yl)-5,5-dimethylheptoxy]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[7-(3-ethenyl-5-hydroxy-2-oxoimidazol-1-yl)-5,5-dimethylheptoxy]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 91373870 |
| Molecular Formula | C22H38N2O5 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 6-[7-(3-ethenyl-5-hydroxy-2-oxoimidazol-1-yl)-5,5-dimethylheptoxy]-2,2-dimethylhexanoic acid |
| SMILES | C=Cn1cc(O)n(CCC(C)(C)CCCCOCCCCC(C)(C)C(=O)O)c1=O |
| InChI | InChI=1S/C22H38N2O5/c1-6-23-17-18(25)24(20(23)28)14-13-21(2,3)11-7-9-15-29-16-10-8-12-22(4,5)19(26)27/h6,17,25H,1,7-16H2,2-5H3,(H,26,27) |
| InChIKey | WAKCTUQRBJHWEX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|