C27H48N2O4 — CID 91143063
3-[2-ethenyl-6-(5-ethenyl-5-ethyl-8-hydroxyoctoxy)-2-ethylhexyl]-1-ethyl-4-hydroxyimidazol-2-one (PubChem CID 91143063) has the molecular formula C27H48N2O4 and a molecular weight of 464.69 g/mol. Its IUPAC name is 3-[2-ethenyl-6-(5-ethenyl-5-ethyl-8-hydroxyoctoxy)-2-ethylhexyl]-1-ethyl-4-hydroxyimidazol-2-one.
| Compound Name | 3-[2-ethenyl-6-(5-ethenyl-5-ethyl-8-hydroxyoctoxy)-2-ethylhexyl]-1-ethyl-4-hydroxyimidazol-2-one |
|---|---|
| PubChem CID | 91143063 |
| Molecular Formula | C27H48N2O4 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 464.36 |
| IUPAC Name | 3-[2-ethenyl-6-(5-ethenyl-5-ethyl-8-hydroxyoctoxy)-2-ethylhexyl]-1-ethyl-4-hydroxyimidazol-2-one |
| SMILES | C=CC(CC)(CCCO)CCCCOCCCCC(C=C)(CC)Cn1c(O)cn(CC)c1=O |
| InChI | InChI=1S/C27H48N2O4/c1-6-26(7-2,18-15-19-30)16-11-13-20-33-21-14-12-17-27(8-3,9-4)23-29-24(31)22-28(10-5)25(29)32/h6,8,22,30-31H,1,3,7,9-21,23H2,2,4-5H3 |
| InChIKey | YZHRGIMRBHJJGD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|