C20H36N2O5 — CID 54353661
7-[5-hydroxy-3-(3-hydroxy-4,4-dimethyloctyl)-2-oxo-1H-imidazol-4-yl]heptanoic acid (PubChem CID 54353661) has the molecular formula C20H36N2O5 and a molecular weight of 384.52 g/mol. Its IUPAC name is 7-[5-hydroxy-3-(3-hydroxy-4,4-dimethyloctyl)-2-oxo-1H-imidazol-4-yl]heptanoic acid.
| Compound Name | 7-[5-hydroxy-3-(3-hydroxy-4,4-dimethyloctyl)-2-oxo-1H-imidazol-4-yl]heptanoic acid |
|---|---|
| PubChem CID | 54353661 |
| Molecular Formula | C20H36N2O5 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 7-[5-hydroxy-3-(3-hydroxy-4,4-dimethyloctyl)-2-oxo-1H-imidazol-4-yl]heptanoic acid |
| SMILES | CCCCC(C)(C)C(O)CCn1c(CCCCCCC(=O)O)c(O)[nH]c1=O |
| InChI | InChI=1S/C20H36N2O5/c1-4-5-13-20(2,3)16(23)12-14-22-15(18(26)21-19(22)27)10-8-6-7-9-11-17(24)25/h16,23,26H,4-14H2,1-3H3,(H,21,27)(H,24,25) |
| InChIKey | UHOQCQJWHWEOLY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|